C24H22F3N7O3S — CID 46841806
N-hydroxy-2-[methyl-[[4-morpholin-4-yl-2-[4-(trifluoromethyl)phenyl]thieno[3,2-d]pyrimidin-6-yl]methyl]amino]pyrimidine-5-carboxamide (PubChem CID 46841806) has the molecular formula C24H22F3N7O3S and a molecular weight of 545.55 g/mol. Its IUPAC name is N-hydroxy-2-[methyl-[[4-morpholin-4-yl-2-[4-(trifluoromethyl)phenyl]thieno[3,2-d]pyrimidin-6-yl]methyl]amino]pyrimidine-5-carboxamide.
| Compound Name | N-hydroxy-2-[methyl-[[4-morpholin-4-yl-2-[4-(trifluoromethyl)phenyl]thieno[3,2-d]pyrimidin-6-yl]methyl]amino]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 46841806 |
| Molecular Formula | C24H22F3N7O3S |
| Molecular Weight | 545.55 g/mol |
| Exact Mass | 545.15 |
| IUPAC Name | N-hydroxy-2-[methyl-[[4-morpholin-4-yl-2-[4-(trifluoromethyl)phenyl]thieno[3,2-d]pyrimidin-6-yl]methyl]amino]pyrimidine-5-carboxamide |
| SMILES | CN(Cc1cc2nc(-c3ccc(C(F)(F)F)cc3)nc(N3CCOCC3)c2s1)c1ncc(C(=O)NO)cn1 |
| InChI | InChI=1S/C24H22F3N7O3S/c1-33(23-28-11-15(12-29-23)22(35)32-36)13-17-10-18-19(38-17)21(34-6-8-37-9-7-34)31-20(30-18)14-2-4-16(5-3-14)24(25,26)27/h2-5,10-12,36H,6-9,13H2,1H3,(H,32,35) |
| InChIKey | DOBYBAWGIADICU-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 116.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.55 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|