C21H23NO3 — CID 46842043
2,2-dideuterio-2-[(11Z)-11-[1,2,2,3,3-pentadeuterio-3-(dimethylamino)propylidene]-6H-benzo[c][1]benzoxepin-2-yl]acetic acid (PubChem CID 46842043) has the molecular formula C21H23NO3 and a molecular weight of 344.46 g/mol. Its IUPAC name is 2,2-dideuterio-2-[(11Z)-11-[1,2,2,3,3-pentadeuterio-3-(dimethylamino)propylidene]-6H-benzo[c][1]benzoxepin-2-yl]acetic acid.
| Compound Name | 2,2-dideuterio-2-[(11Z)-11-[1,2,2,3,3-pentadeuterio-3-(dimethylamino)propylidene]-6H-benzo[c][1]benzoxepin-2-yl]acetic acid |
|---|---|
| PubChem CID | 46842043 |
| Molecular Formula | C21H23NO3 |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.21 |
| IUPAC Name | 2,2-dideuterio-2-[(11Z)-11-[1,2,2,3,3-pentadeuterio-3-(dimethylamino)propylidene]-6H-benzo[c][1]benzoxepin-2-yl]acetic acid |
| SMILES | [2H]/C(=C1\c2ccccc2COc2ccc(C([2H])([2H])C(=O)O)cc21)C([2H])([2H])C([2H])([2H])N(C)C |
| InChI | InChI=1S/C21H23NO3/c1-22(2)11-5-8-18-17-7-4-3-6-16(17)14-25-20-10-9-15(12-19(18)20)13-21(23)24/h3-4,6-10,12H,5,11,13-14H2,1-2H3,(H,23,24)/b18-8-/i5D2,8D,11D2,13D2 |
| InChIKey | JBIMVDZLSHOPLA-HWNTUJFBSA-N |
| XLogP | 3.59 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |