About 3-(4-chlorophenyl)-5-(3,4-dichlorophenyl)-3,4-dihydropyrazole-2-carbothioamide
3-(4-chlorophenyl)-5-(3,4-dichlorophenyl)-3,4-dihydropyrazole-2-carbothioamide (PubChem CID 46842919) has the molecular formula C16H12Cl3N3S
and a molecular weight of 384.72 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-5-(3,4-dichlorophenyl)-3,4-dihydropyrazole-2-carbothioamide.
Molecular Properties
| Compound Name | 3-(4-chlorophenyl)-5-(3,4-dichlorophenyl)-3,4-dihydropyrazole-2-carbothioamide |
| PubChem CID | 46842919 |
| Molecular Formula | C16H12Cl3N3S |
| Molecular Weight | 384.72 g/mol |
| Exact Mass | 382.98 |
| IUPAC Name | 3-(4-chlorophenyl)-5-(3,4-dichlorophenyl)-3,4-dihydropyrazole-2-carbothioamide |
| SMILES | NC(=S)N1N=C(c2ccc(Cl)c(Cl)c2)CC1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H12Cl3N3S/c17-11-4-1-9(2-5-11)15-8-14(21-22(15)16(20)23)10-3-6-12(18)13(19)7-10/h1-7,15H,8H2,(H2,20,23) |
| InChIKey | YCOCXFQEUHIFJW-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 384.72 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3-(4-chlorophenyl)-5-(3,4-dichlorophenyl)-3,4-dihydropyrazole-2-carbothioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-chlorophenyl)-5-(3,4-dichlorophenyl)-3,4-dihydropyrazole-2-carbothioamide?
The IUPAC name of 3-(4-chlorophenyl)-5-(3,4-dichlorophenyl)-3,4-dihydropyrazole-2-carbothioamide (CID 46842919) is 3-(4-chlorophenyl)-5-(3,4-dichlorophenyl)-3,4-dihydropyrazole-2-carbothioamide.
What is the SMILES notation for 3-(4-chlorophenyl)-5-(3,4-dichlorophenyl)-3,4-dihydropyrazole-2-carbothioamide?
The canonical SMILES for 3-(4-chlorophenyl)-5-(3,4-dichlorophenyl)-3,4-dihydropyrazole-2-carbothioamide is NC(=S)N1N=C(c2ccc(Cl)c(Cl)c2)CC1c1ccc(Cl)cc1.
What is the InChIKey of 3-(4-chlorophenyl)-5-(3,4-dichlorophenyl)-3,4-dihydropyrazole-2-carbothioamide?
The InChIKey is YCOCXFQEUHIFJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12Cl3N3S/c17-11-4-1-9(2-5-11)15-8-14(21-22(15)16(20)23)10-3-6-12(18)13(19)7-10/h1-7,15H,8H2,(H2,20,23).
What are the key properties of 3-(4-chlorophenyl)-5-(3,4-dichlorophenyl)-3,4-dihydropyrazole-2-carbothioamide?
3-(4-chlorophenyl)-5-(3,4-dichlorophenyl)-3,4-dihydropyrazole-2-carbothioamide has a molecular weight of 384.72 g/mol, XLogP of 5.04, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-chlorophenyl)-5-(3,4-dichlorophenyl)-3,4-dihydropyrazole-2-carbothioamide is sourced from PubChem (CID 46842919), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).