About (5S)-N-benzyl-3,6-dioxo-1-pentan-3-yl-5-(phenylmethoxymethyl)piperazine-2-carboxamide
(5S)-N-benzyl-3,6-dioxo-1-pentan-3-yl-5-(phenylmethoxymethyl)piperazine-2-carboxamide (PubChem CID 46843760) has the molecular formula C25H31N3O4
and a molecular weight of 437.54 g/mol. Its IUPAC name is (5S)-N-benzyl-3,6-dioxo-1-pentan-3-yl-5-(phenylmethoxymethyl)piperazine-2-carboxamide.
Molecular Properties
| Compound Name | (5S)-N-benzyl-3,6-dioxo-1-pentan-3-yl-5-(phenylmethoxymethyl)piperazine-2-carboxamide |
| PubChem CID | 46843760 |
| Molecular Formula | C25H31N3O4 |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.23 |
| IUPAC Name | (5S)-N-benzyl-3,6-dioxo-1-pentan-3-yl-5-(phenylmethoxymethyl)piperazine-2-carboxamide |
| SMILES | CCC(CC)N1C(=O)[C@H](COCc2ccccc2)NC(=O)C1C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C25H31N3O4/c1-3-20(4-2)28-22(23(29)26-15-18-11-7-5-8-12-18)24(30)27-21(25(28)31)17-32-16-19-13-9-6-10-14-19/h5-14,20-22H,3-4,15-17H2,1-2H3,(H,26,29)(H,27,30)/t21-,22?/m0/s1 |
| InChIKey | XMXXADZGHVJNIL-HMTLIYDFSA-N |
| XLogP | 2.40 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze (5S)-N-benzyl-3,6-dioxo-1-pentan-3-yl-5-(phenylmethoxymethyl)piperazine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5S)-N-benzyl-3,6-dioxo-1-pentan-3-yl-5-(phenylmethoxymethyl)piperazine-2-carboxamide?
The IUPAC name of (5S)-N-benzyl-3,6-dioxo-1-pentan-3-yl-5-(phenylmethoxymethyl)piperazine-2-carboxamide (CID 46843760) is (5S)-N-benzyl-3,6-dioxo-1-pentan-3-yl-5-(phenylmethoxymethyl)piperazine-2-carboxamide.
What is the SMILES notation for (5S)-N-benzyl-3,6-dioxo-1-pentan-3-yl-5-(phenylmethoxymethyl)piperazine-2-carboxamide?
The canonical SMILES for (5S)-N-benzyl-3,6-dioxo-1-pentan-3-yl-5-(phenylmethoxymethyl)piperazine-2-carboxamide is CCC(CC)N1C(=O)[C@H](COCc2ccccc2)NC(=O)C1C(=O)NCc1ccccc1.
What is the InChIKey of (5S)-N-benzyl-3,6-dioxo-1-pentan-3-yl-5-(phenylmethoxymethyl)piperazine-2-carboxamide?
The InChIKey is XMXXADZGHVJNIL-HMTLIYDFSA-N. The full InChI is InChI=1S/C25H31N3O4/c1-3-20(4-2)28-22(23(29)26-15-18-11-7-5-8-12-18)24(30)27-21(25(28)31)17-32-16-19-13-9-6-10-14-19/h5-14,20-22H,3-4,15-17H2,1-2H3,(H,26,29)(H,27,30)/t21-,22?/m0/s1.
What are the key properties of (5S)-N-benzyl-3,6-dioxo-1-pentan-3-yl-5-(phenylmethoxymethyl)piperazine-2-carboxamide?
(5S)-N-benzyl-3,6-dioxo-1-pentan-3-yl-5-(phenylmethoxymethyl)piperazine-2-carboxamide has a molecular weight of 437.54 g/mol, XLogP of 2.40, 10 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (5S)-N-benzyl-3,6-dioxo-1-pentan-3-yl-5-(phenylmethoxymethyl)piperazine-2-carboxamide is sourced from PubChem (CID 46843760), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).