C23H23ClN4O3 — CID 46843819
[13-[(5-chloro-1,3-benzodioxol-4-yl)amino]-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),9,11-tetraen-4-yl]-cyclopentylmethanone (PubChem CID 46843819) has the molecular formula C23H23ClN4O3 and a molecular weight of 438.92 g/mol. Its IUPAC name is [13-[(5-chloro-1,3-benzodioxol-4-yl)amino]-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),9,11-tetraen-4-yl]-cyclopentylmethanone.
| Compound Name | [13-[(5-chloro-1,3-benzodioxol-4-yl)amino]-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),9,11-tetraen-4-yl]-cyclopentylmethanone |
|---|---|
| PubChem CID | 46843819 |
| Molecular Formula | C23H23ClN4O3 |
| Molecular Weight | 438.92 g/mol |
| Exact Mass | 438.15 |
| IUPAC Name | [13-[(5-chloro-1,3-benzodioxol-4-yl)amino]-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),9,11-tetraen-4-yl]-cyclopentylmethanone |
| SMILES | O=C(C1CCCC1)N1CCc2[nH]c3nccc(Nc4c(Cl)ccc5c4OCO5)c3c2C1 |
| InChI | InChI=1S/C23H23ClN4O3/c24-15-5-6-18-21(31-12-30-18)20(15)26-17-7-9-25-22-19(17)14-11-28(10-8-16(14)27-22)23(29)13-3-1-2-4-13/h5-7,9,13H,1-4,8,10-12H2,(H2,25,26,27) |
| InChIKey | RRCLCQYUZCAXHR-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 79.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.92 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |