C14H13N3S — CID 46843885
12-thiophen-3-yl-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraene (PubChem CID 46843885) has the molecular formula C14H13N3S and a molecular weight of 255.35 g/mol. Its IUPAC name is 12-thiophen-3-yl-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraene.
| Compound Name | 12-thiophen-3-yl-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraene |
|---|---|
| PubChem CID | 46843885 |
| Molecular Formula | C14H13N3S |
| Molecular Weight | 255.35 g/mol |
| Exact Mass | 255.08 |
| IUPAC Name | 12-thiophen-3-yl-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraene |
| SMILES | c1cc(-c2cnc3[nH]c4c(c3c2)CNCC4)cs1 |
| InChI | InChI=1S/C14H13N3S/c1-3-15-7-12-11-5-10(9-2-4-18-8-9)6-16-14(11)17-13(1)12/h2,4-6,8,15H,1,3,7H2,(H,16,17) |
| InChIKey | VAKVDZARARAJMH-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.35 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |