C34H52O6Si — CID 46844246
(4S,6S)-6-[(2R,4R,6R)-6-[tert-butyl(diphenyl)silyl]oxy-4-methoxy-2-methylnonyl]-4-(methoxymethoxy)oxan-2-one (PubChem CID 46844246) has the molecular formula C34H52O6Si and a molecular weight of 584.87 g/mol. Its IUPAC name is (4S,6S)-6-[(2R,4R,6R)-6-[tert-butyl(diphenyl)silyl]oxy-4-methoxy-2-methylnonyl]-4-(methoxymethoxy)oxan-2-one.
| Compound Name | (4S,6S)-6-[(2R,4R,6R)-6-[tert-butyl(diphenyl)silyl]oxy-4-methoxy-2-methylnonyl]-4-(methoxymethoxy)oxan-2-one |
|---|---|
| PubChem CID | 46844246 |
| Molecular Formula | C34H52O6Si |
| Molecular Weight | 584.87 g/mol |
| Exact Mass | 584.35 |
| IUPAC Name | (4S,6S)-6-[(2R,4R,6R)-6-[tert-butyl(diphenyl)silyl]oxy-4-methoxy-2-methylnonyl]-4-(methoxymethoxy)oxan-2-one |
| SMILES | CCC[C@H](C[C@@H](C[C@@H](C)C[C@H]1C[C@H](OCOC)CC(=O)O1)OC)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C34H52O6Si/c1-8-15-27(22-28(37-7)20-26(2)21-30-23-29(38-25-36-6)24-33(35)39-30)40-41(34(3,4)5,31-16-11-9-12-17-31)32-18-13-10-14-19-32/h9-14,16-19,26-30H,8,15,20-25H2,1-7H3/t26-,27-,28-,29+,30+/m1/s1 |
| InChIKey | WFBWWOOGZIIGCJ-LBEKWILNSA-N |
| XLogP | 6.25 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.87 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|