C18H30N4O8 — CID 46844356
(E)-N-[3-[(2S,5S)-5-[3-[acetyl(hydroxy)amino]propyl]-4-hydroxy-3,6-dioxopiperazin-2-yl]propyl]-N,5-dihydroxy-3-methylpent-2-enamide (PubChem CID 46844356) has the molecular formula C18H30N4O8 and a molecular weight of 430.46 g/mol. Its IUPAC name is (E)-N-[3-[(2S,5S)-5-[3-[acetyl(hydroxy)amino]propyl]-4-hydroxy-3,6-dioxopiperazin-2-yl]propyl]-N,5-dihydroxy-3-methylpent-2-enamide.
| Compound Name | (E)-N-[3-[(2S,5S)-5-[3-[acetyl(hydroxy)amino]propyl]-4-hydroxy-3,6-dioxopiperazin-2-yl]propyl]-N,5-dihydroxy-3-methylpent-2-enamide |
|---|---|
| PubChem CID | 46844356 |
| Molecular Formula | C18H30N4O8 |
| Molecular Weight | 430.46 g/mol |
| Exact Mass | 430.21 |
| IUPAC Name | (E)-N-[3-[(2S,5S)-5-[3-[acetyl(hydroxy)amino]propyl]-4-hydroxy-3,6-dioxopiperazin-2-yl]propyl]-N,5-dihydroxy-3-methylpent-2-enamide |
| SMILES | CC(=O)N(O)CCC[C@H]1C(=O)N[C@@H](CCCN(O)C(=O)/C=C(\C)CCO)C(=O)N1O |
| InChI | InChI=1S/C18H30N4O8/c1-12(7-10-23)11-16(25)21(29)9-3-5-14-18(27)22(30)15(17(26)19-14)6-4-8-20(28)13(2)24/h11,14-15,23,28-30H,3-10H2,1-2H3,(H,19,26)/b12-11+/t14-,15-/m0/s1 |
| InChIKey | MRHLRICNGQRBQN-NOQIOLJMSA-N |
| XLogP | -0.58 |
| TPSA | 170.95 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.46 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|