C10H8FNO2 — CID 46844549
2-(4-fluorophenyl)-4-methyl-4H-1,3-oxazol-5-one (PubChem CID 46844549) has the molecular formula C10H8FNO2 and a molecular weight of 193.18 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-4-methyl-4H-1,3-oxazol-5-one.
| Compound Name | 2-(4-fluorophenyl)-4-methyl-4H-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 46844549 |
| Molecular Formula | C10H8FNO2 |
| Molecular Weight | 193.18 g/mol |
| Exact Mass | 193.05 |
| IUPAC Name | 2-(4-fluorophenyl)-4-methyl-4H-1,3-oxazol-5-one |
| SMILES | CC1N=C(c2ccc(F)cc2)OC1=O |
| InChI | InChI=1S/C10H8FNO2/c1-6-10(13)14-9(12-6)7-2-4-8(11)5-3-7/h2-6H,1H3 |
| InChIKey | IUSGLUBHDYGJOS-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.18 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |