C10H10Br2O2S — CID 46844732
5,6-bis(bromomethyl)-1,3-dihydro-2-benzothiophene 2,2-dioxide (PubChem CID 46844732) has the molecular formula C10H10Br2O2S and a molecular weight of 354.06 g/mol. Its IUPAC name is 5,6-bis(bromomethyl)-1,3-dihydro-2-benzothiophene 2,2-dioxide.
| Compound Name | 5,6-bis(bromomethyl)-1,3-dihydro-2-benzothiophene 2,2-dioxide |
|---|---|
| PubChem CID | 46844732 |
| Molecular Formula | C10H10Br2O2S |
| Molecular Weight | 354.06 g/mol |
| Exact Mass | 351.88 |
| IUPAC Name | 5,6-bis(bromomethyl)-1,3-dihydro-2-benzothiophene 2,2-dioxide |
| SMILES | O=S1(=O)Cc2cc(CBr)c(CBr)cc2C1 |
| InChI | InChI=1S/C10H10Br2O2S/c11-3-7-1-9-5-15(13,14)6-10(9)2-8(7)4-12/h1-2H,3-6H2 |
| InChIKey | BAZLTMSLCANGKM-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.06 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|