C40H56O6Si — CID 46844801
methyl 2-[(2S,4S,6S)-6-[(2R,4R,6R)-6-[tert-butyl(diphenyl)silyl]oxy-4-methoxy-2-methylnonyl]-2-phenyl-1,3-dioxan-4-yl]acetate (PubChem CID 46844801) has the molecular formula C40H56O6Si and a molecular weight of 660.97 g/mol. Its IUPAC name is methyl 2-[(2S,4S,6S)-6-[(2R,4R,6R)-6-[tert-butyl(diphenyl)silyl]oxy-4-methoxy-2-methylnonyl]-2-phenyl-1,3-dioxan-4-yl]acetate.
| Compound Name | methyl 2-[(2S,4S,6S)-6-[(2R,4R,6R)-6-[tert-butyl(diphenyl)silyl]oxy-4-methoxy-2-methylnonyl]-2-phenyl-1,3-dioxan-4-yl]acetate |
|---|---|
| PubChem CID | 46844801 |
| Molecular Formula | C40H56O6Si |
| Molecular Weight | 660.97 g/mol |
| Exact Mass | 660.38 |
| IUPAC Name | methyl 2-[(2S,4S,6S)-6-[(2R,4R,6R)-6-[tert-butyl(diphenyl)silyl]oxy-4-methoxy-2-methylnonyl]-2-phenyl-1,3-dioxan-4-yl]acetate |
| SMILES | CCC[C@H](C[C@@H](C[C@@H](C)C[C@H]1C[C@@H](CC(=O)OC)O[C@@H](c2ccccc2)O1)OC)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C40H56O6Si/c1-8-18-32(46-47(40(3,4)5,36-21-14-10-15-22-36)37-23-16-11-17-24-37)27-33(42-6)25-30(2)26-34-28-35(29-38(41)43-7)45-39(44-34)31-19-12-9-13-20-31/h9-17,19-24,30,32-35,39H,8,18,25-29H2,1-7H3/t30-,32-,33-,34+,35+,39+/m1/s1 |
| InChIKey | VBADKATZNSIBKZ-BHKUYRFZSA-N |
| XLogP | 7.99 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.97 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|