C32H48O5Si — CID 46844802
(4S,6S)-6-[(2R,4R,6R)-6-[tert-butyl(diphenyl)silyl]oxy-4-methoxy-2-methylnonyl]-4-hydroxyoxan-2-one (PubChem CID 46844802) has the molecular formula C32H48O5Si and a molecular weight of 540.82 g/mol. Its IUPAC name is (4S,6S)-6-[(2R,4R,6R)-6-[tert-butyl(diphenyl)silyl]oxy-4-methoxy-2-methylnonyl]-4-hydroxyoxan-2-one.
| Compound Name | (4S,6S)-6-[(2R,4R,6R)-6-[tert-butyl(diphenyl)silyl]oxy-4-methoxy-2-methylnonyl]-4-hydroxyoxan-2-one |
|---|---|
| PubChem CID | 46844802 |
| Molecular Formula | C32H48O5Si |
| Molecular Weight | 540.82 g/mol |
| Exact Mass | 540.33 |
| IUPAC Name | (4S,6S)-6-[(2R,4R,6R)-6-[tert-butyl(diphenyl)silyl]oxy-4-methoxy-2-methylnonyl]-4-hydroxyoxan-2-one |
| SMILES | CCC[C@H](C[C@@H](C[C@@H](C)C[C@H]1C[C@H](O)CC(=O)O1)OC)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C32H48O5Si/c1-7-14-26(23-27(35-6)19-24(2)20-28-21-25(33)22-31(34)36-28)37-38(32(3,4)5,29-15-10-8-11-16-29)30-17-12-9-13-18-30/h8-13,15-18,24-28,33H,7,14,19-23H2,1-6H3/t24-,25+,26-,27-,28+/m1/s1 |
| InChIKey | YYEITHNRWNTTPP-QLHPUIKHSA-N |
| XLogP | 5.62 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.82 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|