C18H26O3 — CID 46844981
2-[(1R,6R)-6-(2,6-dimethoxyphenyl)-4-methylcyclohex-3-en-1-yl]propan-2-ol (PubChem CID 46844981) has the molecular formula C18H26O3 and a molecular weight of 290.40 g/mol. Its IUPAC name is 2-[(1R,6R)-6-(2,6-dimethoxyphenyl)-4-methylcyclohex-3-en-1-yl]propan-2-ol.
| Compound Name | 2-[(1R,6R)-6-(2,6-dimethoxyphenyl)-4-methylcyclohex-3-en-1-yl]propan-2-ol |
|---|---|
| PubChem CID | 46844981 |
| Molecular Formula | C18H26O3 |
| Molecular Weight | 290.40 g/mol |
| Exact Mass | 290.19 |
| IUPAC Name | 2-[(1R,6R)-6-(2,6-dimethoxyphenyl)-4-methylcyclohex-3-en-1-yl]propan-2-ol |
| SMILES | COc1cccc(OC)c1[C@@H]1CC(C)=CC[C@H]1C(C)(C)O |
| InChI | InChI=1S/C18H26O3/c1-12-9-10-14(18(2,3)19)13(11-12)17-15(20-4)7-6-8-16(17)21-5/h6-9,13-14,19H,10-11H2,1-5H3/t13-,14-/m1/s1 |
| InChIKey | PAQJFFYWSXDVDI-ZIAGYGMSSA-N |
| XLogP | 3.91 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.40 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|