About 3,4-bis(4-tert-butylanilino)cyclobut-3-ene-1,2-dione
3,4-bis(4-tert-butylanilino)cyclobut-3-ene-1,2-dione (PubChem CID 46845217) has the molecular formula C24H28N2O2
and a molecular weight of 376.50 g/mol. Its IUPAC name is 3,4-bis(4-tert-butylanilino)cyclobut-3-ene-1,2-dione.
Molecular Properties
| Compound Name | 3,4-bis(4-tert-butylanilino)cyclobut-3-ene-1,2-dione |
| PubChem CID | 46845217 |
| Molecular Formula | C24H28N2O2 |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.22 |
| IUPAC Name | 3,4-bis(4-tert-butylanilino)cyclobut-3-ene-1,2-dione |
| SMILES | CC(C)(C)c1ccc(Nc2c(Nc3ccc(C(C)(C)C)cc3)c(=O)c2=O)cc1 |
| InChI | InChI=1S/C24H28N2O2/c1-23(2,3)15-7-11-17(12-8-15)25-19-20(22(28)21(19)27)26-18-13-9-16(10-14-18)24(4,5)6/h7-14,25-26H,1-6H3 |
| InChIKey | NACXEYHDFJYAED-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 3,4-bis(4-tert-butylanilino)cyclobut-3-ene-1,2-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-bis(4-tert-butylanilino)cyclobut-3-ene-1,2-dione?
The IUPAC name of 3,4-bis(4-tert-butylanilino)cyclobut-3-ene-1,2-dione (CID 46845217) is 3,4-bis(4-tert-butylanilino)cyclobut-3-ene-1,2-dione.
What is the SMILES notation for 3,4-bis(4-tert-butylanilino)cyclobut-3-ene-1,2-dione?
The canonical SMILES for 3,4-bis(4-tert-butylanilino)cyclobut-3-ene-1,2-dione is CC(C)(C)c1ccc(Nc2c(Nc3ccc(C(C)(C)C)cc3)c(=O)c2=O)cc1.
What is the InChIKey of 3,4-bis(4-tert-butylanilino)cyclobut-3-ene-1,2-dione?
The InChIKey is NACXEYHDFJYAED-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H28N2O2/c1-23(2,3)15-7-11-17(12-8-15)25-19-20(22(28)21(19)27)26-18-13-9-16(10-14-18)24(4,5)6/h7-14,25-26H,1-6H3.
What are the key properties of 3,4-bis(4-tert-butylanilino)cyclobut-3-ene-1,2-dione?
3,4-bis(4-tert-butylanilino)cyclobut-3-ene-1,2-dione has a molecular weight of 376.50 g/mol, XLogP of 5.36, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-bis(4-tert-butylanilino)cyclobut-3-ene-1,2-dione is sourced from PubChem (CID 46845217), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).