About [(2S,3R)-3-[tert-butyl(dimethyl)silyl]oxy-1-[(1R)-1-phenylethyl]piperidin-2-yl]methyl acetate
[(2S,3R)-3-[tert-butyl(dimethyl)silyl]oxy-1-[(1R)-1-phenylethyl]piperidin-2-yl]methyl acetate (PubChem CID 46845310) has the molecular formula C22H37NO3Si
and a molecular weight of 391.63 g/mol. Its IUPAC name is [(2S,3R)-3-[tert-butyl(dimethyl)silyl]oxy-1-[(1R)-1-phenylethyl]piperidin-2-yl]methyl acetate.
Molecular Properties
| Compound Name | [(2S,3R)-3-[tert-butyl(dimethyl)silyl]oxy-1-[(1R)-1-phenylethyl]piperidin-2-yl]methyl acetate |
| PubChem CID | 46845310 |
| Molecular Formula | C22H37NO3Si |
| Molecular Weight | 391.63 g/mol |
| Exact Mass | 391.25 |
| IUPAC Name | [(2S,3R)-3-[tert-butyl(dimethyl)silyl]oxy-1-[(1R)-1-phenylethyl]piperidin-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1[C@H](O[Si](C)(C)C(C)(C)C)CCCN1[C@H](C)c1ccccc1 |
| InChI | InChI=1S/C22H37NO3Si/c1-17(19-12-9-8-10-13-19)23-15-11-14-21(20(23)16-25-18(2)24)26-27(6,7)22(3,4)5/h8-10,12-13,17,20-21H,11,14-16H2,1-7H3/t17-,20+,21-/m1/s1 |
| InChIKey | AWURROBMVCRXOT-JRGCBEDISA-N |
| XLogP | 5.17 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 391.63 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [(2S,3R)-3-[tert-butyl(dimethyl)silyl]oxy-1-[(1R)-1-phenylethyl]piperidin-2-yl]methyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S,3R)-3-[tert-butyl(dimethyl)silyl]oxy-1-[(1R)-1-phenylethyl]piperidin-2-yl]methyl acetate?
The IUPAC name of [(2S,3R)-3-[tert-butyl(dimethyl)silyl]oxy-1-[(1R)-1-phenylethyl]piperidin-2-yl]methyl acetate (CID 46845310) is [(2S,3R)-3-[tert-butyl(dimethyl)silyl]oxy-1-[(1R)-1-phenylethyl]piperidin-2-yl]methyl acetate.
What is the SMILES notation for [(2S,3R)-3-[tert-butyl(dimethyl)silyl]oxy-1-[(1R)-1-phenylethyl]piperidin-2-yl]methyl acetate?
The canonical SMILES for [(2S,3R)-3-[tert-butyl(dimethyl)silyl]oxy-1-[(1R)-1-phenylethyl]piperidin-2-yl]methyl acetate is CC(=O)OC[C@H]1[C@H](O[Si](C)(C)C(C)(C)C)CCCN1[C@H](C)c1ccccc1.
What is the InChIKey of [(2S,3R)-3-[tert-butyl(dimethyl)silyl]oxy-1-[(1R)-1-phenylethyl]piperidin-2-yl]methyl acetate?
The InChIKey is AWURROBMVCRXOT-JRGCBEDISA-N. The full InChI is InChI=1S/C22H37NO3Si/c1-17(19-12-9-8-10-13-19)23-15-11-14-21(20(23)16-25-18(2)24)26-27(6,7)22(3,4)5/h8-10,12-13,17,20-21H,11,14-16H2,1-7H3/t17-,20+,21-/m1/s1.
What are the key properties of [(2S,3R)-3-[tert-butyl(dimethyl)silyl]oxy-1-[(1R)-1-phenylethyl]piperidin-2-yl]methyl acetate?
[(2S,3R)-3-[tert-butyl(dimethyl)silyl]oxy-1-[(1R)-1-phenylethyl]piperidin-2-yl]methyl acetate has a molecular weight of 391.63 g/mol, XLogP of 5.17, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S,3R)-3-[tert-butyl(dimethyl)silyl]oxy-1-[(1R)-1-phenylethyl]piperidin-2-yl]methyl acetate is sourced from PubChem (CID 46845310), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).