About 3-(4-bromophenyl)-2-pentyl-1,5-diphenylpyrrole
3-(4-bromophenyl)-2-pentyl-1,5-diphenylpyrrole (PubChem CID 46845679) has the molecular formula C27H26BrN
and a molecular weight of 444.42 g/mol. Its IUPAC name is 3-(4-bromophenyl)-2-pentyl-1,5-diphenylpyrrole.
Molecular Properties
| Compound Name | 3-(4-bromophenyl)-2-pentyl-1,5-diphenylpyrrole |
| PubChem CID | 46845679 |
| Molecular Formula | C27H26BrN |
| Molecular Weight | 444.42 g/mol |
| Exact Mass | 443.12 |
| IUPAC Name | 3-(4-bromophenyl)-2-pentyl-1,5-diphenylpyrrole |
| SMILES | CCCCCc1c(-c2ccc(Br)cc2)cc(-c2ccccc2)n1-c1ccccc1 |
| InChI | InChI=1S/C27H26BrN/c1-2-3-6-15-26-25(21-16-18-23(28)19-17-21)20-27(22-11-7-4-8-12-22)29(26)24-13-9-5-10-14-24/h4-5,7-14,16-20H,2-3,6,15H2,1H3 |
| InChIKey | YVVBQQWSJFNZMD-UHFFFAOYSA-N |
| XLogP | 8.31 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 444.42 |
| LogP ≤ 5 | 8.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-(4-bromophenyl)-2-pentyl-1,5-diphenylpyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-bromophenyl)-2-pentyl-1,5-diphenylpyrrole?
The IUPAC name of 3-(4-bromophenyl)-2-pentyl-1,5-diphenylpyrrole (CID 46845679) is 3-(4-bromophenyl)-2-pentyl-1,5-diphenylpyrrole.
What is the SMILES notation for 3-(4-bromophenyl)-2-pentyl-1,5-diphenylpyrrole?
The canonical SMILES for 3-(4-bromophenyl)-2-pentyl-1,5-diphenylpyrrole is CCCCCc1c(-c2ccc(Br)cc2)cc(-c2ccccc2)n1-c1ccccc1.
What is the InChIKey of 3-(4-bromophenyl)-2-pentyl-1,5-diphenylpyrrole?
The InChIKey is YVVBQQWSJFNZMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H26BrN/c1-2-3-6-15-26-25(21-16-18-23(28)19-17-21)20-27(22-11-7-4-8-12-22)29(26)24-13-9-5-10-14-24/h4-5,7-14,16-20H,2-3,6,15H2,1H3.
What are the key properties of 3-(4-bromophenyl)-2-pentyl-1,5-diphenylpyrrole?
3-(4-bromophenyl)-2-pentyl-1,5-diphenylpyrrole has a molecular weight of 444.42 g/mol, XLogP of 8.31, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-bromophenyl)-2-pentyl-1,5-diphenylpyrrole is sourced from PubChem (CID 46845679), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).