C37H47N3O9S2 — CID 46845837
2-[2-[[4-(benzenesulfonyl)-5-oxido-1,2,5-oxadiazol-5-ium-3-yl]oxy]ethoxy]ethyl (2S)-2-[[2-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylbenzoyl]amino]propanoate (PubChem CID 46845837) has the molecular formula C37H47N3O9S2 and a molecular weight of 741.93 g/mol. Its IUPAC name is 2-[2-[[4-(benzenesulfonyl)-5-oxido-1,2,5-oxadiazol-5-ium-3-yl]oxy]ethoxy]ethyl (2S)-2-[[2-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylbenzoyl]amino]propanoate.
| Compound Name | 2-[2-[[4-(benzenesulfonyl)-5-oxido-1,2,5-oxadiazol-5-ium-3-yl]oxy]ethoxy]ethyl (2S)-2-[[2-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylbenzoyl]amino]propanoate |
|---|---|
| PubChem CID | 46845837 |
| Molecular Formula | C37H47N3O9S2 |
| Molecular Weight | 741.93 g/mol |
| Exact Mass | 741.28 |
| IUPAC Name | 2-[2-[[4-(benzenesulfonyl)-5-oxido-1,2,5-oxadiazol-5-ium-3-yl]oxy]ethoxy]ethyl (2S)-2-[[2-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylbenzoyl]amino]propanoate |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CSc1ccccc1C(=O)N[C@@H](C)C(=O)OCCOCCOc1no[n+]([O-])c1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C37H47N3O9S2/c1-27(2)13-11-14-28(3)15-12-16-29(4)21-26-50-33-20-10-9-19-32(33)34(41)38-30(5)37(42)48-25-23-46-22-24-47-35-36(40(43)49-39-35)51(44,45)31-17-7-6-8-18-31/h6-10,13,15,17-21,30H,11-12,14,16,22-26H2,1-5H3,(H,38,41)/b28-15+,29-21+/t30-/m0/s1 |
| InChIKey | JLKUKOUXEVPGQG-MYEUQPDOSA-N |
| XLogP | 6.41 |
| TPSA | 160.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 741.93 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'} |
|---|