C30H42O — CID 46846122
(4E,6E,8E,10E,12E,14E,16E,18E,20E)-2,6,10,14,19,23-hexamethyltetracosa-4,6,8,10,12,14,16,18,20,22-decaen-2-ol (PubChem CID 46846122) has the molecular formula C30H42O and a molecular weight of 418.67 g/mol. Its IUPAC name is (4E,6E,8E,10E,12E,14E,16E,18E,20E)-2,6,10,14,19,23-hexamethyltetracosa-4,6,8,10,12,14,16,18,20,22-decaen-2-ol.
| Compound Name | (4E,6E,8E,10E,12E,14E,16E,18E,20E)-2,6,10,14,19,23-hexamethyltetracosa-4,6,8,10,12,14,16,18,20,22-decaen-2-ol |
|---|---|
| PubChem CID | 46846122 |
| Molecular Formula | C30H42O |
| Molecular Weight | 418.67 g/mol |
| Exact Mass | 418.32 |
| IUPAC Name | (4E,6E,8E,10E,12E,14E,16E,18E,20E)-2,6,10,14,19,23-hexamethyltetracosa-4,6,8,10,12,14,16,18,20,22-decaen-2-ol |
| SMILES | CC(C)=C/C=C/C(C)=C/C=C/C=C(C)/C=C/C=C(C)/C=C/C=C(C)/C=C/CC(C)(C)O |
| InChI | InChI=1S/C30H42O/c1-25(2)15-11-18-26(3)16-9-10-17-27(4)19-12-20-28(5)21-13-22-29(6)23-14-24-30(7,8)31/h9-23,31H,24H2,1-8H3/b10-9+,18-11+,19-12+,21-13+,23-14+,26-16+,27-17+,28-20+,29-22+ |
| InChIKey | FOIFOTKOVLXQJE-GOWUZQRBSA-N |
| XLogP | 8.68 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.67 |
| LogP ≤ 5 | 8.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|