C15H18O3 — CID 46846153
(1S,8R,9S)-5-methoxy-4,8-dimethyl-10-oxatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-11-one (PubChem CID 46846153) has the molecular formula C15H18O3 and a molecular weight of 246.31 g/mol. Its IUPAC name is (1S,8R,9S)-5-methoxy-4,8-dimethyl-10-oxatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-11-one.
| Compound Name | (1S,8R,9S)-5-methoxy-4,8-dimethyl-10-oxatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-11-one |
|---|---|
| PubChem CID | 46846153 |
| Molecular Formula | C15H18O3 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.13 |
| IUPAC Name | (1S,8R,9S)-5-methoxy-4,8-dimethyl-10-oxatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-11-one |
| SMILES | COc1cc2c(cc1C)[C@@H]1CC(=O)O[C@@H](C1)[C@@H]2C |
| InChI | InChI=1S/C15H18O3/c1-8-4-12-10-5-14(18-15(16)6-10)9(2)11(12)7-13(8)17-3/h4,7,9-10,14H,5-6H2,1-3H3/t9-,10+,14+/m1/s1 |
| InChIKey | ADAJMIPBAZCEGS-BFVZDQMLSA-N |
| XLogP | 2.91 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |