C28H26N2O5 — CID 46846542
ethyl 3-[2-[(Z)-[6-(4-hydroxyphenyl)-2-oxo-1H-indol-3-ylidene]methyl]-4-oxo-1,5,6,7-tetrahydroindol-3-yl]propanoate (PubChem CID 46846542) has the molecular formula C28H26N2O5 and a molecular weight of 470.53 g/mol. Its IUPAC name is ethyl 3-[2-[(Z)-[6-(4-hydroxyphenyl)-2-oxo-1H-indol-3-ylidene]methyl]-4-oxo-1,5,6,7-tetrahydroindol-3-yl]propanoate.
| Compound Name | ethyl 3-[2-[(Z)-[6-(4-hydroxyphenyl)-2-oxo-1H-indol-3-ylidene]methyl]-4-oxo-1,5,6,7-tetrahydroindol-3-yl]propanoate |
|---|---|
| PubChem CID | 46846542 |
| Molecular Formula | C28H26N2O5 |
| Molecular Weight | 470.53 g/mol |
| Exact Mass | 470.18 |
| IUPAC Name | ethyl 3-[2-[(Z)-[6-(4-hydroxyphenyl)-2-oxo-1H-indol-3-ylidene]methyl]-4-oxo-1,5,6,7-tetrahydroindol-3-yl]propanoate |
| SMILES | CCOC(=O)CCc1c(/C=C2\C(=O)Nc3cc(-c4ccc(O)cc4)ccc32)[nH]c2c1C(=O)CCC2 |
| InChI | InChI=1S/C28H26N2O5/c1-2-35-26(33)13-12-20-24(29-22-4-3-5-25(32)27(20)22)15-21-19-11-8-17(14-23(19)30-28(21)34)16-6-9-18(31)10-7-16/h6-11,14-15,29,31H,2-5,12-13H2,1H3,(H,30,34)/b21-15- |
| InChIKey | UGLSIZZHWXSLPS-QNGOZBTKSA-N |
| XLogP | 4.89 |
| TPSA | 108.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.53 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|