C34H30ClNO4 — CID 46846592
2,3,7,8-tetramethoxy-5-methyl-1-(4-phenylphenyl)benzo[c]phenanthridin-5-ium chloride (PubChem CID 46846592) has the molecular formula C34H30ClNO4 and a molecular weight of 552.07 g/mol. Its IUPAC name is 2,3,7,8-tetramethoxy-5-methyl-1-(4-phenylphenyl)benzo[c]phenanthridin-5-ium chloride.
| Compound Name | 2,3,7,8-tetramethoxy-5-methyl-1-(4-phenylphenyl)benzo[c]phenanthridin-5-ium chloride |
|---|---|
| PubChem CID | 46846592 |
| Molecular Formula | C34H30ClNO4 |
| Molecular Weight | 552.07 g/mol |
| Exact Mass | 551.19 |
| IUPAC Name | 2,3,7,8-tetramethoxy-5-methyl-1-(4-phenylphenyl)benzo[c]phenanthridin-5-ium chloride |
| SMILES | COc1cc2c(ccc3c4ccc(OC)c(OC)c4c[n+](C)c23)c(-c2ccc(-c3ccccc3)cc2)c1OC.[Cl-] |
| InChI | InChI=1S/C34H30NO4.ClH/c1-35-20-28-24(17-18-29(36-2)33(28)38-4)26-16-15-25-27(32(26)35)19-30(37-3)34(39-5)31(25)23-13-11-22(12-14-23)21-9-7-6-8-10-21;/h6-20H,1-5H3;1H/q+1;/p-1 |
| InChIKey | OCXDMWHDIYSXTN-UHFFFAOYSA-M |
| XLogP | 4.34 |
| TPSA | 40.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.07 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|