C17H27NO — CID 46846600
(E)-3-[(4S,7R,7aR)-3,7-dimethyl-2,4,5,6,7,7a-hexahydro-1H-inden-4-yl]-N,N,2-trimethylprop-2-enamide (PubChem CID 46846600) has the molecular formula C17H27NO and a molecular weight of 261.41 g/mol. Its IUPAC name is (E)-3-[(4S,7R,7aR)-3,7-dimethyl-2,4,5,6,7,7a-hexahydro-1H-inden-4-yl]-N,N,2-trimethylprop-2-enamide.
| Compound Name | (E)-3-[(4S,7R,7aR)-3,7-dimethyl-2,4,5,6,7,7a-hexahydro-1H-inden-4-yl]-N,N,2-trimethylprop-2-enamide |
|---|---|
| PubChem CID | 46846600 |
| Molecular Formula | C17H27NO |
| Molecular Weight | 261.41 g/mol |
| Exact Mass | 261.21 |
| IUPAC Name | (E)-3-[(4S,7R,7aR)-3,7-dimethyl-2,4,5,6,7,7a-hexahydro-1H-inden-4-yl]-N,N,2-trimethylprop-2-enamide |
| SMILES | CC1=C2[C@H](/C=C(\C)C(=O)N(C)C)CC[C@@H](C)[C@H]2CC1 |
| InChI | InChI=1S/C17H27NO/c1-11-6-8-14(10-13(3)17(19)18(4)5)16-12(2)7-9-15(11)16/h10-11,14-15H,6-9H2,1-5H3/b13-10+/t11-,14+,15-/m1/s1 |
| InChIKey | SKOSWJXUJIZPKO-BIPQPYMZSA-N |
| XLogP | 3.79 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.41 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|