C21H20ClN3OS — CID 46846730
3-chloro-2,6-dimethyl-5-[4-[3-[methyl(1,3-thiazol-2-ylmethyl)amino]prop-1-ynyl]phenyl]-1H-pyridin-4-one (PubChem CID 46846730) has the molecular formula C21H20ClN3OS and a molecular weight of 397.93 g/mol. Its IUPAC name is 3-chloro-2,6-dimethyl-5-[4-[3-[methyl(1,3-thiazol-2-ylmethyl)amino]prop-1-ynyl]phenyl]-1H-pyridin-4-one.
| Compound Name | 3-chloro-2,6-dimethyl-5-[4-[3-[methyl(1,3-thiazol-2-ylmethyl)amino]prop-1-ynyl]phenyl]-1H-pyridin-4-one |
|---|---|
| PubChem CID | 46846730 |
| Molecular Formula | C21H20ClN3OS |
| Molecular Weight | 397.93 g/mol |
| Exact Mass | 397.10 |
| IUPAC Name | 3-chloro-2,6-dimethyl-5-[4-[3-[methyl(1,3-thiazol-2-ylmethyl)amino]prop-1-ynyl]phenyl]-1H-pyridin-4-one |
| SMILES | Cc1[nH]c(C)c(-c2ccc(C#CCN(C)Cc3nccs3)cc2)c(=O)c1Cl |
| InChI | InChI=1S/C21H20ClN3OS/c1-14-19(21(26)20(22)15(2)24-14)17-8-6-16(7-9-17)5-4-11-25(3)13-18-23-10-12-27-18/h6-10,12H,11,13H2,1-3H3,(H,24,26) |
| InChIKey | ZTSPOQFYYCHXCH-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.93 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|