C30H31N2O4+ — CID 46846784
N,N-dimethyl-4-(2,3,7,8-tetramethoxy-5-methylbenzo[c]phenanthridin-5-ium-1-yl)aniline (PubChem CID 46846784) has the molecular formula C30H31N2O4+ and a molecular weight of 483.59 g/mol. Its IUPAC name is N,N-dimethyl-4-(2,3,7,8-tetramethoxy-5-methylbenzo[c]phenanthridin-5-ium-1-yl)aniline.
| Compound Name | N,N-dimethyl-4-(2,3,7,8-tetramethoxy-5-methylbenzo[c]phenanthridin-5-ium-1-yl)aniline |
|---|---|
| PubChem CID | 46846784 |
| Molecular Formula | C30H31N2O4+ |
| Molecular Weight | 483.59 g/mol |
| Exact Mass | 483.23 |
| IUPAC Name | N,N-dimethyl-4-(2,3,7,8-tetramethoxy-5-methylbenzo[c]phenanthridin-5-ium-1-yl)aniline |
| SMILES | COc1cc2c(ccc3c4ccc(OC)c(OC)c4c[n+](C)c23)c(-c2ccc(N(C)C)cc2)c1OC |
| InChI | InChI=1S/C30H31N2O4/c1-31(2)19-10-8-18(9-11-19)27-21-12-13-22-20-14-15-25(33-4)29(35-6)24(20)17-32(3)28(22)23(21)16-26(34-5)30(27)36-7/h8-17H,1-7H3/q+1 |
| InChIKey | CVYCTVBXZVCSTF-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 44.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.59 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|