C22H20N2O2 — CID 46847003
(E)-3-(4-benzyl-2,3,3a,8b-tetrahydro-1H-cyclopenta[b]indol-7-yl)-2-cyanoprop-2-enoic acid (PubChem CID 46847003) has the molecular formula C22H20N2O2 and a molecular weight of 344.41 g/mol. Its IUPAC name is (E)-3-(4-benzyl-2,3,3a,8b-tetrahydro-1H-cyclopenta[b]indol-7-yl)-2-cyanoprop-2-enoic acid.
| Compound Name | (E)-3-(4-benzyl-2,3,3a,8b-tetrahydro-1H-cyclopenta[b]indol-7-yl)-2-cyanoprop-2-enoic acid |
|---|---|
| PubChem CID | 46847003 |
| Molecular Formula | C22H20N2O2 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.15 |
| IUPAC Name | (E)-3-(4-benzyl-2,3,3a,8b-tetrahydro-1H-cyclopenta[b]indol-7-yl)-2-cyanoprop-2-enoic acid |
| SMILES | N#C/C(=C\c1ccc2c(c1)C1CCCC1N2Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C22H20N2O2/c23-13-17(22(25)26)11-16-9-10-21-19(12-16)18-7-4-8-20(18)24(21)14-15-5-2-1-3-6-15/h1-3,5-6,9-12,18,20H,4,7-8,14H2,(H,25,26)/b17-11+ |
| InChIKey | NXOGMSADWGKOGE-GZTJUZNOSA-N |
| XLogP | 4.33 |
| TPSA | 64.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|