About 4-(6-chloroimidazo[1,2-b]pyridazine-3-carbonyl)-N-cyclohexyl-N-ethylbenzamide
4-(6-chloroimidazo[1,2-b]pyridazine-3-carbonyl)-N-cyclohexyl-N-ethylbenzamide (PubChem CID 46847215) has the molecular formula C22H23ClN4O2
and a molecular weight of 410.91 g/mol. Its IUPAC name is 4-(6-chloroimidazo[1,2-b]pyridazine-3-carbonyl)-N-cyclohexyl-N-ethylbenzamide.
Molecular Properties
| Compound Name | 4-(6-chloroimidazo[1,2-b]pyridazine-3-carbonyl)-N-cyclohexyl-N-ethylbenzamide |
| PubChem CID | 46847215 |
| Molecular Formula | C22H23ClN4O2 |
| Molecular Weight | 410.91 g/mol |
| Exact Mass | 410.15 |
| IUPAC Name | 4-(6-chloroimidazo[1,2-b]pyridazine-3-carbonyl)-N-cyclohexyl-N-ethylbenzamide |
| SMILES | CCN(C(=O)c1ccc(C(=O)c2cnc3ccc(Cl)nn23)cc1)C1CCCCC1 |
| InChI | InChI=1S/C22H23ClN4O2/c1-2-26(17-6-4-3-5-7-17)22(29)16-10-8-15(9-11-16)21(28)18-14-24-20-13-12-19(23)25-27(18)20/h8-14,17H,2-7H2,1H3 |
| InChIKey | WURNROSIJDLPMN-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 67.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 410.91 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-(6-chloroimidazo[1,2-b]pyridazine-3-carbonyl)-N-cyclohexyl-N-ethylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(6-chloroimidazo[1,2-b]pyridazine-3-carbonyl)-N-cyclohexyl-N-ethylbenzamide?
The IUPAC name of 4-(6-chloroimidazo[1,2-b]pyridazine-3-carbonyl)-N-cyclohexyl-N-ethylbenzamide (CID 46847215) is 4-(6-chloroimidazo[1,2-b]pyridazine-3-carbonyl)-N-cyclohexyl-N-ethylbenzamide.
What is the SMILES notation for 4-(6-chloroimidazo[1,2-b]pyridazine-3-carbonyl)-N-cyclohexyl-N-ethylbenzamide?
The canonical SMILES for 4-(6-chloroimidazo[1,2-b]pyridazine-3-carbonyl)-N-cyclohexyl-N-ethylbenzamide is CCN(C(=O)c1ccc(C(=O)c2cnc3ccc(Cl)nn23)cc1)C1CCCCC1.
What is the InChIKey of 4-(6-chloroimidazo[1,2-b]pyridazine-3-carbonyl)-N-cyclohexyl-N-ethylbenzamide?
The InChIKey is WURNROSIJDLPMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H23ClN4O2/c1-2-26(17-6-4-3-5-7-17)22(29)16-10-8-15(9-11-16)21(28)18-14-24-20-13-12-19(23)25-27(18)20/h8-14,17H,2-7H2,1H3.
What are the key properties of 4-(6-chloroimidazo[1,2-b]pyridazine-3-carbonyl)-N-cyclohexyl-N-ethylbenzamide?
4-(6-chloroimidazo[1,2-b]pyridazine-3-carbonyl)-N-cyclohexyl-N-ethylbenzamide has a molecular weight of 410.91 g/mol, XLogP of 4.41, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(6-chloroimidazo[1,2-b]pyridazine-3-carbonyl)-N-cyclohexyl-N-ethylbenzamide is sourced from PubChem (CID 46847215), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).