C20H17BrN2O3S — CID 46847378
3-[2-[(Z)-(6-bromo-2-sulfanylidene-1H-indol-3-ylidene)methyl]-4-oxo-1,5,6,7-tetrahydroindol-3-yl]propanoic acid (PubChem CID 46847378) has the molecular formula C20H17BrN2O3S and a molecular weight of 445.34 g/mol. Its IUPAC name is 3-[2-[(Z)-(6-bromo-2-sulfanylidene-1H-indol-3-ylidene)methyl]-4-oxo-1,5,6,7-tetrahydroindol-3-yl]propanoic acid.
| Compound Name | 3-[2-[(Z)-(6-bromo-2-sulfanylidene-1H-indol-3-ylidene)methyl]-4-oxo-1,5,6,7-tetrahydroindol-3-yl]propanoic acid |
|---|---|
| PubChem CID | 46847378 |
| Molecular Formula | C20H17BrN2O3S |
| Molecular Weight | 445.34 g/mol |
| Exact Mass | 444.01 |
| IUPAC Name | 3-[2-[(Z)-(6-bromo-2-sulfanylidene-1H-indol-3-ylidene)methyl]-4-oxo-1,5,6,7-tetrahydroindol-3-yl]propanoic acid |
| SMILES | O=C(O)CCc1c(/C=C2\C(=S)Nc3cc(Br)ccc32)[nH]c2c1C(=O)CCC2 |
| InChI | InChI=1S/C20H17BrN2O3S/c21-10-4-5-11-13(20(27)23-15(11)8-10)9-16-12(6-7-18(25)26)19-14(22-16)2-1-3-17(19)24/h4-5,8-9,22H,1-3,6-7H2,(H,23,27)(H,25,26)/b13-9- |
| InChIKey | HGZGUGJVXMFXLW-LCYFTJDESA-N |
| XLogP | 4.61 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.34 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|