C20H21F3N4O2 — CID 46847737
1-methyl-N-(2-morpholin-4-ylethyl)-5-[2-[2-(trifluoromethyl)phenyl]ethynyl]pyrazole-3-carboxamide (PubChem CID 46847737) has the molecular formula C20H21F3N4O2 and a molecular weight of 406.41 g/mol. Its IUPAC name is 1-methyl-N-(2-morpholin-4-ylethyl)-5-[2-[2-(trifluoromethyl)phenyl]ethynyl]pyrazole-3-carboxamide.
| Compound Name | 1-methyl-N-(2-morpholin-4-ylethyl)-5-[2-[2-(trifluoromethyl)phenyl]ethynyl]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 46847737 |
| Molecular Formula | C20H21F3N4O2 |
| Molecular Weight | 406.41 g/mol |
| Exact Mass | 406.16 |
| IUPAC Name | 1-methyl-N-(2-morpholin-4-ylethyl)-5-[2-[2-(trifluoromethyl)phenyl]ethynyl]pyrazole-3-carboxamide |
| SMILES | Cn1nc(C(=O)NCCN2CCOCC2)cc1C#Cc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C20H21F3N4O2/c1-26-16(7-6-15-4-2-3-5-17(15)20(21,22)23)14-18(25-26)19(28)24-8-9-27-10-12-29-13-11-27/h2-5,14H,8-13H2,1H3,(H,24,28) |
| InChIKey | OEDAOSJJLSXCTJ-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.41 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|