C23H9F13OS — CID 46848113
S-[3-[2,3,5,6-tetrafluoro-4-[2,3,5,6-tetrafluoro-4-(2,3,4,5,6-pentafluorophenyl)phenyl]phenyl]propyl] ethanethioate (PubChem CID 46848113) has the molecular formula C23H9F13OS and a molecular weight of 580.37 g/mol. Its IUPAC name is S-[3-[2,3,5,6-tetrafluoro-4-[2,3,5,6-tetrafluoro-4-(2,3,4,5,6-pentafluorophenyl)phenyl]phenyl]propyl] ethanethioate.
| Compound Name | S-[3-[2,3,5,6-tetrafluoro-4-[2,3,5,6-tetrafluoro-4-(2,3,4,5,6-pentafluorophenyl)phenyl]phenyl]propyl] ethanethioate |
|---|---|
| PubChem CID | 46848113 |
| Molecular Formula | C23H9F13OS |
| Molecular Weight | 580.37 g/mol |
| Exact Mass | 580.02 |
| IUPAC Name | S-[3-[2,3,5,6-tetrafluoro-4-[2,3,5,6-tetrafluoro-4-(2,3,4,5,6-pentafluorophenyl)phenyl]phenyl]propyl] ethanethioate |
| SMILES | CC(=O)SCCCc1c(F)c(F)c(-c2c(F)c(F)c(-c3c(F)c(F)c(F)c(F)c3F)c(F)c2F)c(F)c1F |
| InChI | InChI=1S/C23H9F13OS/c1-5(37)38-4-2-3-6-11(24)13(26)7(14(27)12(6)25)8-15(28)17(30)9(18(31)16(8)29)10-19(32)21(34)23(36)22(35)20(10)33/h2-4H2,1H3 |
| InChIKey | XUGUNEKCSCZWIO-UHFFFAOYSA-N |
| XLogP | 8.04 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.37 |
| LogP ≤ 5 | 8.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|