C21H7F13S — CID 46848114
3-[2,3,5,6-tetrafluoro-4-[2,3,5,6-tetrafluoro-4-(2,3,4,5,6-pentafluorophenyl)phenyl]phenyl]propane-1-thiol (PubChem CID 46848114) has the molecular formula C21H7F13S and a molecular weight of 538.33 g/mol. Its IUPAC name is 3-[2,3,5,6-tetrafluoro-4-[2,3,5,6-tetrafluoro-4-(2,3,4,5,6-pentafluorophenyl)phenyl]phenyl]propane-1-thiol.
| Compound Name | 3-[2,3,5,6-tetrafluoro-4-[2,3,5,6-tetrafluoro-4-(2,3,4,5,6-pentafluorophenyl)phenyl]phenyl]propane-1-thiol |
|---|---|
| PubChem CID | 46848114 |
| Molecular Formula | C21H7F13S |
| Molecular Weight | 538.33 g/mol |
| Exact Mass | 538.01 |
| IUPAC Name | 3-[2,3,5,6-tetrafluoro-4-[2,3,5,6-tetrafluoro-4-(2,3,4,5,6-pentafluorophenyl)phenyl]phenyl]propane-1-thiol |
| SMILES | Fc1c(F)c(F)c(-c2c(F)c(F)c(-c3c(F)c(F)c(CCCS)c(F)c3F)c(F)c2F)c(F)c1F |
| InChI | InChI=1S/C21H7F13S/c22-9-4(2-1-3-35)10(23)12(25)5(11(9)24)6-13(26)15(28)7(16(29)14(6)27)8-17(30)19(32)21(34)20(33)18(8)31/h35H,1-3H2 |
| InChIKey | ASGSXEBVUGCBAI-UHFFFAOYSA-N |
| XLogP | 7.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.33 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|