C20H32N2O8 — CID 46848281
tetraethyl 5-(tert-butylamino)-3,4-dihydropyrrole-2,2,3,4-tetracarboxylate (PubChem CID 46848281) has the molecular formula C20H32N2O8 and a molecular weight of 428.48 g/mol. Its IUPAC name is tetraethyl 5-(tert-butylamino)-3,4-dihydropyrrole-2,2,3,4-tetracarboxylate.
| Compound Name | tetraethyl 5-(tert-butylamino)-3,4-dihydropyrrole-2,2,3,4-tetracarboxylate |
|---|---|
| PubChem CID | 46848281 |
| Molecular Formula | C20H32N2O8 |
| Molecular Weight | 428.48 g/mol |
| Exact Mass | 428.22 |
| IUPAC Name | tetraethyl 5-(tert-butylamino)-3,4-dihydropyrrole-2,2,3,4-tetracarboxylate |
| SMILES | CCOC(=O)C1C(NC(C)(C)C)=NC(C(=O)OCC)(C(=O)OCC)C1C(=O)OCC |
| InChI | InChI=1S/C20H32N2O8/c1-8-27-15(23)12-13(16(24)28-9-2)20(17(25)29-10-3,18(26)30-11-4)22-14(12)21-19(5,6)7/h12-13H,8-11H2,1-7H3,(H,21,22) |
| InChIKey | MMXFNARYAXRXCT-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 129.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.48 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|