C17H11F8N3O3 — CID 46848569
2-(2,2,3,3,3-pentafluoropropoxy)-3-[4-(2,2,2-trifluoroethoxy)phenyl]-7H-pyrrolo[2,3-d]pyrimidin-4-one (PubChem CID 46848569) has the molecular formula C17H11F8N3O3 and a molecular weight of 457.28 g/mol. Its IUPAC name is 2-(2,2,3,3,3-pentafluoropropoxy)-3-[4-(2,2,2-trifluoroethoxy)phenyl]-7H-pyrrolo[2,3-d]pyrimidin-4-one.
| Compound Name | 2-(2,2,3,3,3-pentafluoropropoxy)-3-[4-(2,2,2-trifluoroethoxy)phenyl]-7H-pyrrolo[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 46848569 |
| Molecular Formula | C17H11F8N3O3 |
| Molecular Weight | 457.28 g/mol |
| Exact Mass | 457.07 |
| IUPAC Name | 2-(2,2,3,3,3-pentafluoropropoxy)-3-[4-(2,2,2-trifluoroethoxy)phenyl]-7H-pyrrolo[2,3-d]pyrimidin-4-one |
| SMILES | O=c1c2cc[nH]c2nc(OCC(F)(F)C(F)(F)F)n1-c1ccc(OCC(F)(F)F)cc1 |
| InChI | InChI=1S/C17H11F8N3O3/c18-15(19,17(23,24)25)7-31-14-27-12-11(5-6-26-12)13(29)28(14)9-1-3-10(4-2-9)30-8-16(20,21)22/h1-6,26H,7-8H2 |
| InChIKey | OKEJRVUEIKFGIW-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 69.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.28 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|