About 4-(aminomethyl)-3-N,5-N-diethylpyridazine-3,5-diamine
4-(aminomethyl)-3-N,5-N-diethylpyridazine-3,5-diamine (PubChem CID 46848634) has the molecular formula C9H17N5
and a molecular weight of 195.27 g/mol. Its IUPAC name is 4-(aminomethyl)-3-N,5-N-diethylpyridazine-3,5-diamine.
Molecular Properties
| Compound Name | 4-(aminomethyl)-3-N,5-N-diethylpyridazine-3,5-diamine |
| PubChem CID | 46848634 |
| Molecular Formula | C9H17N5 |
| Molecular Weight | 195.27 g/mol |
| Exact Mass | 195.15 |
| IUPAC Name | 4-(aminomethyl)-3-N,5-N-diethylpyridazine-3,5-diamine |
| SMILES | CCNc1cnnc(NCC)c1CN |
| InChI | InChI=1S/C9H17N5/c1-3-11-8-6-13-14-9(12-4-2)7(8)5-10/h6H,3-5,10H2,1-2H3,(H2,11,12,14) |
| InChIKey | WIUJUMUCLHTPHM-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.27 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-(aminomethyl)-3-N,5-N-diethylpyridazine-3,5-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(aminomethyl)-3-N,5-N-diethylpyridazine-3,5-diamine?
The IUPAC name of 4-(aminomethyl)-3-N,5-N-diethylpyridazine-3,5-diamine (CID 46848634) is 4-(aminomethyl)-3-N,5-N-diethylpyridazine-3,5-diamine.
What is the SMILES notation for 4-(aminomethyl)-3-N,5-N-diethylpyridazine-3,5-diamine?
The canonical SMILES for 4-(aminomethyl)-3-N,5-N-diethylpyridazine-3,5-diamine is CCNc1cnnc(NCC)c1CN.
What is the InChIKey of 4-(aminomethyl)-3-N,5-N-diethylpyridazine-3,5-diamine?
The InChIKey is WIUJUMUCLHTPHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17N5/c1-3-11-8-6-13-14-9(12-4-2)7(8)5-10/h6H,3-5,10H2,1-2H3,(H2,11,12,14).
What are the key properties of 4-(aminomethyl)-3-N,5-N-diethylpyridazine-3,5-diamine?
4-(aminomethyl)-3-N,5-N-diethylpyridazine-3,5-diamine has a molecular weight of 195.27 g/mol, XLogP of 0.80, 5 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(aminomethyl)-3-N,5-N-diethylpyridazine-3,5-diamine is sourced from PubChem (CID 46848634), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).