C22H30O5 — CID 46848879
(1S,2E,5S,8E,10Z,14E,17R)-5-(hydroxymethyl)-3,11-dimethyl-6,21-dioxabicyclo[15.3.1]henicosa-2,8,10,14-tetraene-7,13-dione (PubChem CID 46848879) has the molecular formula C22H30O5 and a molecular weight of 374.48 g/mol. Its IUPAC name is (1S,2E,5S,8E,10Z,14E,17R)-5-(hydroxymethyl)-3,11-dimethyl-6,21-dioxabicyclo[15.3.1]henicosa-2,8,10,14-tetraene-7,13-dione.
| Compound Name | (1S,2E,5S,8E,10Z,14E,17R)-5-(hydroxymethyl)-3,11-dimethyl-6,21-dioxabicyclo[15.3.1]henicosa-2,8,10,14-tetraene-7,13-dione |
|---|---|
| PubChem CID | 46848879 |
| Molecular Formula | C22H30O5 |
| Molecular Weight | 374.48 g/mol |
| Exact Mass | 374.21 |
| IUPAC Name | (1S,2E,5S,8E,10Z,14E,17R)-5-(hydroxymethyl)-3,11-dimethyl-6,21-dioxabicyclo[15.3.1]henicosa-2,8,10,14-tetraene-7,13-dione |
| SMILES | C/C1=C/C=C/C(=O)O[C@H](CO)C/C(C)=C/[C@@H]2CCC[C@H](C/C=C/C(=O)C1)O2 |
| InChI | InChI=1S/C22H30O5/c1-16-6-3-11-22(25)27-21(15-23)14-17(2)13-20-10-5-9-19(26-20)8-4-7-18(24)12-16/h3-4,6-7,11,13,19-21,23H,5,8-10,12,14-15H2,1-2H3/b7-4+,11-3+,16-6-,17-13+/t19-,20-,21-/m0/s1 |
| InChIKey | QFGPNLFINCWSBM-ALENQBTRSA-N |
| XLogP | 3.59 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.48 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|