C15H15Br2ClO2 — CID 46848955
(2S,3R)-3,8-dibromo-6-chloro-2-cyclohexyl-2,3-dihydrochromen-4-one (PubChem CID 46848955) has the molecular formula C15H15Br2ClO2 and a molecular weight of 422.54 g/mol. Its IUPAC name is (2S,3R)-3,8-dibromo-6-chloro-2-cyclohexyl-2,3-dihydrochromen-4-one.
| Compound Name | (2S,3R)-3,8-dibromo-6-chloro-2-cyclohexyl-2,3-dihydrochromen-4-one |
|---|---|
| PubChem CID | 46848955 |
| Molecular Formula | C15H15Br2ClO2 |
| Molecular Weight | 422.54 g/mol |
| Exact Mass | 419.91 |
| IUPAC Name | (2S,3R)-3,8-dibromo-6-chloro-2-cyclohexyl-2,3-dihydrochromen-4-one |
| SMILES | O=C1c2cc(Cl)cc(Br)c2O[C@@H](C2CCCCC2)[C@H]1Br |
| InChI | InChI=1S/C15H15Br2ClO2/c16-11-7-9(18)6-10-13(19)12(17)14(20-15(10)11)8-4-2-1-3-5-8/h6-8,12,14H,1-5H2/t12-,14-/m0/s1 |
| InChIKey | CEBSVVCOURAJOP-JSGCOSHPSA-N |
| XLogP | 5.39 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.54 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|