C30H50O4 — CID 46849018
(6R)-2-methyl-6-[(1R,3R,6S,8R,11S,12S,14S,15R,16R,17S)-6,14,17-trihydroxy-7,7,12,16-tetramethyl-15-pentacyclo[9.7.0.01,3.03,8.012,16]octadecanyl]heptan-3-one (PubChem CID 46849018) has the molecular formula C30H50O4 and a molecular weight of 474.73 g/mol. Its IUPAC name is (6R)-2-methyl-6-[(1R,3R,6S,8R,11S,12S,14S,15R,16R,17S)-6,14,17-trihydroxy-7,7,12,16-tetramethyl-15-pentacyclo[9.7.0.01,3.03,8.012,16]octadecanyl]heptan-3-one.
| Compound Name | (6R)-2-methyl-6-[(1R,3R,6S,8R,11S,12S,14S,15R,16R,17S)-6,14,17-trihydroxy-7,7,12,16-tetramethyl-15-pentacyclo[9.7.0.01,3.03,8.012,16]octadecanyl]heptan-3-one |
|---|---|
| PubChem CID | 46849018 |
| Molecular Formula | C30H50O4 |
| Molecular Weight | 474.73 g/mol |
| Exact Mass | 474.37 |
| IUPAC Name | (6R)-2-methyl-6-[(1R,3R,6S,8R,11S,12S,14S,15R,16R,17S)-6,14,17-trihydroxy-7,7,12,16-tetramethyl-15-pentacyclo[9.7.0.01,3.03,8.012,16]octadecanyl]heptan-3-one |
| SMILES | CC(C)C(=O)CC[C@@H](C)[C@H]1[C@@H](O)C[C@@]2(C)[C@@H]3CC[C@H]4C(C)(C)[C@@H](O)CC[C@@]45C[C@@]35C[C@H](O)[C@]12C |
| InChI | InChI=1S/C30H50O4/c1-17(2)19(31)9-8-18(3)25-20(32)14-27(6)22-11-10-21-26(4,5)23(33)12-13-29(21)16-30(22,29)15-24(34)28(25,27)7/h17-18,20-25,32-34H,8-16H2,1-7H3/t18-,20+,21+,22+,23+,24+,25+,27+,28-,29-,30+/m1/s1 |
| InChIKey | DOWYNWQUMLPHSD-PCGSKIRXSA-N |
| XLogP | 5.37 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.73 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |