C20H18O3 — CID 46849026
(1S,16S,17S)-17-hydroxy-1-methyl-14-oxapentacyclo[11.6.1.02,11.04,9.016,20]icosa-2,4,6,8,10,13(20)-hexaen-12-one (PubChem CID 46849026) has the molecular formula C20H18O3 and a molecular weight of 306.36 g/mol. Its IUPAC name is (1S,16S,17S)-17-hydroxy-1-methyl-14-oxapentacyclo[11.6.1.02,11.04,9.016,20]icosa-2,4,6,8,10,13(20)-hexaen-12-one.
| Compound Name | (1S,16S,17S)-17-hydroxy-1-methyl-14-oxapentacyclo[11.6.1.02,11.04,9.016,20]icosa-2,4,6,8,10,13(20)-hexaen-12-one |
|---|---|
| PubChem CID | 46849026 |
| Molecular Formula | C20H18O3 |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.13 |
| IUPAC Name | (1S,16S,17S)-17-hydroxy-1-methyl-14-oxapentacyclo[11.6.1.02,11.04,9.016,20]icosa-2,4,6,8,10,13(20)-hexaen-12-one |
| SMILES | C[C@@]12CC[C@H](O)[C@@H]3COC(=C31)C(=O)c1cc3ccccc3cc12 |
| InChI | InChI=1S/C20H18O3/c1-20-7-6-16(21)14-10-23-19(17(14)20)18(22)13-8-11-4-2-3-5-12(11)9-15(13)20/h2-5,8-9,14,16,21H,6-7,10H2,1H3/t14-,16-,20-/m0/s1 |
| InChIKey | PWROZXKBOIMYBW-UVFQYZLESA-N |
| XLogP | 3.35 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |