C17H16ClN3OS — CID 46849031
(3S,4S,5S)-4-chloro-N-methyl-3-phenyl-5-phenylsulfanyl-3,4-dihydropyrazole-5-carboxamide (PubChem CID 46849031) has the molecular formula C17H16ClN3OS and a molecular weight of 345.86 g/mol. Its IUPAC name is (3S,4S,5S)-4-chloro-N-methyl-3-phenyl-5-phenylsulfanyl-3,4-dihydropyrazole-5-carboxamide.
| Compound Name | (3S,4S,5S)-4-chloro-N-methyl-3-phenyl-5-phenylsulfanyl-3,4-dihydropyrazole-5-carboxamide |
|---|---|
| PubChem CID | 46849031 |
| Molecular Formula | C17H16ClN3OS |
| Molecular Weight | 345.86 g/mol |
| Exact Mass | 345.07 |
| IUPAC Name | (3S,4S,5S)-4-chloro-N-methyl-3-phenyl-5-phenylsulfanyl-3,4-dihydropyrazole-5-carboxamide |
| SMILES | CNC(=O)[C@@]1(Sc2ccccc2)N=N[C@@H](c2ccccc2)[C@@H]1Cl |
| InChI | InChI=1S/C17H16ClN3OS/c1-19-16(22)17(23-13-10-6-3-7-11-13)15(18)14(20-21-17)12-8-4-2-5-9-12/h2-11,14-15H,1H3,(H,19,22)/t14-,15-,17+/m0/s1 |
| InChIKey | ZQFZOVAZTZOCDX-YQQAZPJKSA-N |
| XLogP | 4.04 |
| TPSA | 53.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.86 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|