C45H64 — CID 46849152
1-[1,1-bis(3,5-ditert-butylphenyl)prop-2-ynyl]-3,5-ditert-butylbenzene (PubChem CID 46849152) has the molecular formula C45H64 and a molecular weight of 605.01 g/mol. Its IUPAC name is 1-[1,1-bis(3,5-ditert-butylphenyl)prop-2-ynyl]-3,5-ditert-butylbenzene.
| Compound Name | 1-[1,1-bis(3,5-ditert-butylphenyl)prop-2-ynyl]-3,5-ditert-butylbenzene |
|---|---|
| PubChem CID | 46849152 |
| Molecular Formula | C45H64 |
| Molecular Weight | 605.01 g/mol |
| Exact Mass | 604.50 |
| IUPAC Name | 1-[1,1-bis(3,5-ditert-butylphenyl)prop-2-ynyl]-3,5-ditert-butylbenzene |
| SMILES | C#CC(c1cc(C(C)(C)C)cc(C(C)(C)C)c1)(c1cc(C(C)(C)C)cc(C(C)(C)C)c1)c1cc(C(C)(C)C)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C45H64/c1-20-45(36-24-30(39(2,3)4)21-31(25-36)40(5,6)7,37-26-32(41(8,9)10)22-33(27-37)42(11,12)13)38-28-34(43(14,15)16)23-35(29-38)44(17,18)19/h1,21-29H,2-19H3 |
| InChIKey | XNKYGTWZVKPKEE-UHFFFAOYSA-N |
| XLogP | 12.44 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.01 |
| LogP ≤ 5 | 12.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|