C33H34N2O8S2 — CID 46849160
[(1R,2S,4S)-1-(benzenesulfonylmethyl)-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl] 2-[(S)-benzenesulfonamido-(4-nitrophenyl)methyl]buta-2,3-dienoate (PubChem CID 46849160) has the molecular formula C33H34N2O8S2 and a molecular weight of 650.78 g/mol. Its IUPAC name is [(1R,2S,4S)-1-(benzenesulfonylmethyl)-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl] 2-[(S)-benzenesulfonamido-(4-nitrophenyl)methyl]buta-2,3-dienoate.
| Compound Name | [(1R,2S,4S)-1-(benzenesulfonylmethyl)-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl] 2-[(S)-benzenesulfonamido-(4-nitrophenyl)methyl]buta-2,3-dienoate |
|---|---|
| PubChem CID | 46849160 |
| Molecular Formula | C33H34N2O8S2 |
| Molecular Weight | 650.78 g/mol |
| Exact Mass | 650.18 |
| IUPAC Name | [(1R,2S,4S)-1-(benzenesulfonylmethyl)-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl] 2-[(S)-benzenesulfonamido-(4-nitrophenyl)methyl]buta-2,3-dienoate |
| SMILES | C=C=C(C(=O)O[C@H]1C[C@@H]2CC[C@@]1(CS(=O)(=O)c1ccccc1)C2(C)C)[C@@H](NS(=O)(=O)c1ccccc1)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C33H34N2O8S2/c1-4-28(30(23-15-17-25(18-16-23)35(37)38)34-45(41,42)27-13-9-6-10-14-27)31(36)43-29-21-24-19-20-33(29,32(24,2)3)22-44(39,40)26-11-7-5-8-12-26/h5-18,24,29-30,34H,1,19-22H2,2-3H3/t24-,29-,30-,33-/m0/s1 |
| InChIKey | LLIUZSNJIGAWTC-PBGSARALSA-N |
| XLogP | 5.54 |
| TPSA | 149.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.78 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|