C19H23N3 — CID 46849461
(2S,4aR,5S)-2-benzyl-5-methyl-2,3,4,4a,5,6-hexahydro-1H-pyrazino[1,2-a]quinoxaline (PubChem CID 46849461) has the molecular formula C19H23N3 and a molecular weight of 293.41 g/mol. Its IUPAC name is (2S,4aR,5S)-2-benzyl-5-methyl-2,3,4,4a,5,6-hexahydro-1H-pyrazino[1,2-a]quinoxaline.
| Compound Name | (2S,4aR,5S)-2-benzyl-5-methyl-2,3,4,4a,5,6-hexahydro-1H-pyrazino[1,2-a]quinoxaline |
|---|---|
| PubChem CID | 46849461 |
| Molecular Formula | C19H23N3 |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.19 |
| IUPAC Name | (2S,4aR,5S)-2-benzyl-5-methyl-2,3,4,4a,5,6-hexahydro-1H-pyrazino[1,2-a]quinoxaline |
| SMILES | C[C@@H]1Nc2ccccc2N2C[C@H](Cc3ccccc3)NC[C@H]12 |
| InChI | InChI=1S/C19H23N3/c1-14-19-12-20-16(11-15-7-3-2-4-8-15)13-22(19)18-10-6-5-9-17(18)21-14/h2-10,14,16,19-21H,11-13H2,1H3/t14-,16-,19+/m0/s1 |
| InChIKey | YNJWFGIISFQESM-URLQWDBASA-N |
| XLogP | 2.89 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |