C12H15NO5 — CID 46849638
(3R,4'S,5'R)-4',5'-dihydroxyspiro[1,4-dihydropyrrolo[2,1-c][1,4]oxazine-3,2'-oxane]-6-carbaldehyde (PubChem CID 46849638) has the molecular formula C12H15NO5 and a molecular weight of 253.25 g/mol. Its IUPAC name is (3R,4'S,5'R)-4',5'-dihydroxyspiro[1,4-dihydropyrrolo[2,1-c][1,4]oxazine-3,2'-oxane]-6-carbaldehyde.
| Compound Name | (3R,4'S,5'R)-4',5'-dihydroxyspiro[1,4-dihydropyrrolo[2,1-c][1,4]oxazine-3,2'-oxane]-6-carbaldehyde |
|---|---|
| PubChem CID | 46849638 |
| Molecular Formula | C12H15NO5 |
| Molecular Weight | 253.25 g/mol |
| Exact Mass | 253.10 |
| IUPAC Name | (3R,4'S,5'R)-4',5'-dihydroxyspiro[1,4-dihydropyrrolo[2,1-c][1,4]oxazine-3,2'-oxane]-6-carbaldehyde |
| SMILES | O=Cc1ccc2n1C[C@]1(C[C@H](O)[C@H](O)CO1)OC2 |
| InChI | InChI=1S/C12H15NO5/c14-4-8-1-2-9-5-17-12(7-13(8)9)3-10(15)11(16)6-18-12/h1-2,4,10-11,15-16H,3,5-7H2/t10-,11+,12+/m0/s1 |
| InChIKey | LBDLCFRRMWTKQR-QJPTWQEYSA-N |
| XLogP | -0.33 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.25 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|