About 2-amino-3-(1,3-thiazol-2-yl)propanoic acid
2-amino-3-(1,3-thiazol-2-yl)propanoic acid (PubChem CID 4684973) has the molecular formula C6H8N2O2S
and a molecular weight of 172.21 g/mol. Its IUPAC name is 2-amino-3-(1,3-thiazol-2-yl)propanoic acid.
Molecular Properties
| Compound Name | 2-amino-3-(1,3-thiazol-2-yl)propanoic acid |
| PubChem CID | 4684973 |
| Molecular Formula | C6H8N2O2S |
| Molecular Weight | 172.21 g/mol |
| Exact Mass | 172.03 |
| IUPAC Name | 2-amino-3-(1,3-thiazol-2-yl)propanoic acid |
| SMILES | NC(Cc1nccs1)C(=O)O |
| InChI | InChI=1S/C6H8N2O2S/c7-4(6(9)10)3-5-8-1-2-11-5/h1-2,4H,3,7H2,(H,9,10) |
| InChIKey | PXFXXRSFSGRBRT-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 76.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.21 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-amino-3-(1,3-thiazol-2-yl)propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-3-(1,3-thiazol-2-yl)propanoic acid?
The IUPAC name of 2-amino-3-(1,3-thiazol-2-yl)propanoic acid (CID 4684973) is 2-amino-3-(1,3-thiazol-2-yl)propanoic acid.
What is the SMILES notation for 2-amino-3-(1,3-thiazol-2-yl)propanoic acid?
The canonical SMILES for 2-amino-3-(1,3-thiazol-2-yl)propanoic acid is NC(Cc1nccs1)C(=O)O.
What is the InChIKey of 2-amino-3-(1,3-thiazol-2-yl)propanoic acid?
The InChIKey is PXFXXRSFSGRBRT-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N2O2S/c7-4(6(9)10)3-5-8-1-2-11-5/h1-2,4H,3,7H2,(H,9,10).
What are the key properties of 2-amino-3-(1,3-thiazol-2-yl)propanoic acid?
2-amino-3-(1,3-thiazol-2-yl)propanoic acid has a molecular weight of 172.21 g/mol, XLogP of 0.10, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-3-(1,3-thiazol-2-yl)propanoic acid is sourced from PubChem (CID 4684973), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).