About [2-hydroxy-3-methoxy-6-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl] 4-methylbenzenesulfonate
[2-hydroxy-3-methoxy-6-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl] 4-methylbenzenesulfonate (PubChem CID 46849792) has the molecular formula C25H26O8S
and a molecular weight of 486.54 g/mol. Its IUPAC name is [2-hydroxy-3-methoxy-6-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl] 4-methylbenzenesulfonate.
Molecular Properties
| Compound Name | [2-hydroxy-3-methoxy-6-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl] 4-methylbenzenesulfonate |
| PubChem CID | 46849792 |
| Molecular Formula | C25H26O8S |
| Molecular Weight | 486.54 g/mol |
| Exact Mass | 486.13 |
| IUPAC Name | [2-hydroxy-3-methoxy-6-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl] 4-methylbenzenesulfonate |
| SMILES | COc1ccc(/C=C\c2cc(OC)c(OC)c(OC)c2)c(OS(=O)(=O)c2ccc(C)cc2)c1O |
| InChI | InChI=1S/C25H26O8S/c1-16-6-11-19(12-7-16)34(27,28)33-24-18(10-13-20(29-2)23(24)26)9-8-17-14-21(30-3)25(32-5)22(15-17)31-4/h6-15,26H,1-5H3/b9-8- |
| InChIKey | IGHFUNKKIJQFNN-HJWRWDBZSA-N |
| XLogP | 4.67 |
| TPSA | 100.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 486.54 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [2-hydroxy-3-methoxy-6-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl] 4-methylbenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-hydroxy-3-methoxy-6-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl] 4-methylbenzenesulfonate?
The IUPAC name of [2-hydroxy-3-methoxy-6-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl] 4-methylbenzenesulfonate (CID 46849792) is [2-hydroxy-3-methoxy-6-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl] 4-methylbenzenesulfonate.
What is the SMILES notation for [2-hydroxy-3-methoxy-6-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl] 4-methylbenzenesulfonate?
The canonical SMILES for [2-hydroxy-3-methoxy-6-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl] 4-methylbenzenesulfonate is COc1ccc(/C=C\c2cc(OC)c(OC)c(OC)c2)c(OS(=O)(=O)c2ccc(C)cc2)c1O.
What is the InChIKey of [2-hydroxy-3-methoxy-6-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl] 4-methylbenzenesulfonate?
The InChIKey is IGHFUNKKIJQFNN-HJWRWDBZSA-N. The full InChI is InChI=1S/C25H26O8S/c1-16-6-11-19(12-7-16)34(27,28)33-24-18(10-13-20(29-2)23(24)26)9-8-17-14-21(30-3)25(32-5)22(15-17)31-4/h6-15,26H,1-5H3/b9-8-.
What are the key properties of [2-hydroxy-3-methoxy-6-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl] 4-methylbenzenesulfonate?
[2-hydroxy-3-methoxy-6-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl] 4-methylbenzenesulfonate has a molecular weight of 486.54 g/mol, XLogP of 4.67, 9 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for [2-hydroxy-3-methoxy-6-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl] 4-methylbenzenesulfonate is sourced from PubChem (CID 46849792), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).