C20H32Si — CID 46849823
2-(2,6-ditert-butylcyclohepta-2,4,6-trien-1-yl)ethynyl-trimethylsilane (PubChem CID 46849823) has the molecular formula C20H32Si and a molecular weight of 300.56 g/mol. Its IUPAC name is 2-(2,6-ditert-butylcyclohepta-2,4,6-trien-1-yl)ethynyl-trimethylsilane.
| Compound Name | 2-(2,6-ditert-butylcyclohepta-2,4,6-trien-1-yl)ethynyl-trimethylsilane |
|---|---|
| PubChem CID | 46849823 |
| Molecular Formula | C20H32Si |
| Molecular Weight | 300.56 g/mol |
| Exact Mass | 300.23 |
| IUPAC Name | 2-(2,6-ditert-butylcyclohepta-2,4,6-trien-1-yl)ethynyl-trimethylsilane |
| SMILES | CC(C)(C)C1=CC(C#C[Si](C)(C)C)C(C(C)(C)C)=CC=C1 |
| InChI | InChI=1S/C20H32Si/c1-19(2,3)17-11-10-12-18(20(4,5)6)16(15-17)13-14-21(7,8)9/h10-12,15-16H,1-9H3 |
| InChIKey | QTWRFUFQLFPXLB-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.56 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|