C22H34N4O4 — CID 46849843
(2E,4E,6E)-N-[(3S,6S,9S)-3,4-dimethyl-2,5,8-trioxo-6-propan-2-yl-1,4,7-triazacyclododec-9-yl]octa-2,4,6-trienamide (PubChem CID 46849843) has the molecular formula C22H34N4O4 and a molecular weight of 418.54 g/mol. Its IUPAC name is (2E,4E,6E)-N-[(3S,6S,9S)-3,4-dimethyl-2,5,8-trioxo-6-propan-2-yl-1,4,7-triazacyclododec-9-yl]octa-2,4,6-trienamide.
| Compound Name | (2E,4E,6E)-N-[(3S,6S,9S)-3,4-dimethyl-2,5,8-trioxo-6-propan-2-yl-1,4,7-triazacyclododec-9-yl]octa-2,4,6-trienamide |
|---|---|
| PubChem CID | 46849843 |
| Molecular Formula | C22H34N4O4 |
| Molecular Weight | 418.54 g/mol |
| Exact Mass | 418.26 |
| IUPAC Name | (2E,4E,6E)-N-[(3S,6S,9S)-3,4-dimethyl-2,5,8-trioxo-6-propan-2-yl-1,4,7-triazacyclododec-9-yl]octa-2,4,6-trienamide |
| SMILES | C/C=C/C=C/C=C/C(=O)N[C@H]1CCCNC(=O)[C@H](C)N(C)C(=O)[C@H](C(C)C)NC1=O |
| InChI | InChI=1S/C22H34N4O4/c1-6-7-8-9-10-13-18(27)24-17-12-11-14-23-20(28)16(4)26(5)22(30)19(15(2)3)25-21(17)29/h6-10,13,15-17,19H,11-12,14H2,1-5H3,(H,23,28)(H,24,27)(H,25,29)/b7-6+,9-8+,13-10+/t16-,17-,19-/m0/s1 |
| InChIKey | ZRECDKRYGORPRG-VUOPYGPLSA-N |
| XLogP | 1.06 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.54 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|