C31H55IO4Si — CID 46849959
(1E,3E,5R,6R,8E,10E,14S,15S)-1-iodo-14-(methoxymethoxy)-3,5,8-trimethyl-15-tri(propan-2-yl)silyloxyheptadeca-1,3,8,10,16-pentaen-6-ol (PubChem CID 46849959) has the molecular formula C31H55IO4Si and a molecular weight of 646.77 g/mol. Its IUPAC name is (1E,3E,5R,6R,8E,10E,14S,15S)-1-iodo-14-(methoxymethoxy)-3,5,8-trimethyl-15-tri(propan-2-yl)silyloxyheptadeca-1,3,8,10,16-pentaen-6-ol.
| Compound Name | (1E,3E,5R,6R,8E,10E,14S,15S)-1-iodo-14-(methoxymethoxy)-3,5,8-trimethyl-15-tri(propan-2-yl)silyloxyheptadeca-1,3,8,10,16-pentaen-6-ol |
|---|---|
| PubChem CID | 46849959 |
| Molecular Formula | C31H55IO4Si |
| Molecular Weight | 646.77 g/mol |
| Exact Mass | 646.29 |
| IUPAC Name | (1E,3E,5R,6R,8E,10E,14S,15S)-1-iodo-14-(methoxymethoxy)-3,5,8-trimethyl-15-tri(propan-2-yl)silyloxyheptadeca-1,3,8,10,16-pentaen-6-ol |
| SMILES | C=C[C@H](O[Si](C(C)C)(C(C)C)C(C)C)[C@H](CC/C=C/C=C(\C)C[C@@H](O)[C@H](C)/C=C(C)/C=C/I)OCOC |
| InChI | InChI=1S/C31H55IO4Si/c1-12-30(36-37(23(2)3,24(4)5)25(6)7)31(35-22-34-11)17-15-13-14-16-26(8)21-29(33)28(10)20-27(9)18-19-32/h12-14,16,18-20,23-25,28-31,33H,1,15,17,21-22H2,2-11H3/b14-13+,19-18+,26-16+,27-20+/t28-,29-,30+,31+/m1/s1 |
| InChIKey | ZBIPXJWJLWFXPX-LHNIKZGUSA-N |
| XLogP | 9.29 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.77 |
| LogP ≤ 5 | 9.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|