C59H74F2O — CID 46850148
6-[3,5-difluoro-4-[5,5,5-tris(3,5-ditert-butylphenyl)penta-1,3-diynyl]phenyl]hex-5-yn-1-ol (PubChem CID 46850148) has the molecular formula C59H74F2O and a molecular weight of 837.24 g/mol. Its IUPAC name is 6-[3,5-difluoro-4-[5,5,5-tris(3,5-ditert-butylphenyl)penta-1,3-diynyl]phenyl]hex-5-yn-1-ol.
| Compound Name | 6-[3,5-difluoro-4-[5,5,5-tris(3,5-ditert-butylphenyl)penta-1,3-diynyl]phenyl]hex-5-yn-1-ol |
|---|---|
| PubChem CID | 46850148 |
| Molecular Formula | C59H74F2O |
| Molecular Weight | 837.24 g/mol |
| Exact Mass | 836.57 |
| IUPAC Name | 6-[3,5-difluoro-4-[5,5,5-tris(3,5-ditert-butylphenyl)penta-1,3-diynyl]phenyl]hex-5-yn-1-ol |
| SMILES | CC(C)(C)c1cc(C(C)(C)C)cc(C(C#CC#Cc2c(F)cc(C#CCCCCO)cc2F)(c2cc(C(C)(C)C)cc(C(C)(C)C)c2)c2cc(C(C)(C)C)cc(C(C)(C)C)c2)c1 |
| InChI | InChI=1S/C59H74F2O/c1-53(2,3)41-31-42(54(4,5)6)35-47(34-41)59(48-36-43(55(7,8)9)32-44(37-48)56(10,11)12,49-38-45(57(13,14)15)33-46(39-49)58(16,17)18)27-23-22-26-50-51(60)29-40(30-52(50)61)25-21-19-20-24-28-62/h29-39,62H,19-20,24,28H2,1-18H3 |
| InChIKey | AWCYSNPUHARGSL-UHFFFAOYSA-N |
| XLogP | 14.65 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 837.24 |
| LogP ≤ 5 | 14.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|