C59H73BrF2 — CID 46850149
5-(6-bromohex-1-ynyl)-1,3-difluoro-2-[5,5,5-tris(3,5-ditert-butylphenyl)penta-1,3-diynyl]benzene (PubChem CID 46850149) has the molecular formula C59H73BrF2 and a molecular weight of 900.13 g/mol. Its IUPAC name is 5-(6-bromohex-1-ynyl)-1,3-difluoro-2-[5,5,5-tris(3,5-ditert-butylphenyl)penta-1,3-diynyl]benzene.
| Compound Name | 5-(6-bromohex-1-ynyl)-1,3-difluoro-2-[5,5,5-tris(3,5-ditert-butylphenyl)penta-1,3-diynyl]benzene |
|---|---|
| PubChem CID | 46850149 |
| Molecular Formula | C59H73BrF2 |
| Molecular Weight | 900.13 g/mol |
| Exact Mass | 898.49 |
| IUPAC Name | 5-(6-bromohex-1-ynyl)-1,3-difluoro-2-[5,5,5-tris(3,5-ditert-butylphenyl)penta-1,3-diynyl]benzene |
| SMILES | CC(C)(C)c1cc(C(C)(C)C)cc(C(C#CC#Cc2c(F)cc(C#CCCCCBr)cc2F)(c2cc(C(C)(C)C)cc(C(C)(C)C)c2)c2cc(C(C)(C)C)cc(C(C)(C)C)c2)c1 |
| InChI | InChI=1S/C59H73BrF2/c1-53(2,3)41-31-42(54(4,5)6)35-47(34-41)59(48-36-43(55(7,8)9)32-44(37-48)56(10,11)12,49-38-45(57(13,14)15)33-46(39-49)58(16,17)18)27-23-22-26-50-51(61)29-40(30-52(50)62)25-21-19-20-24-28-60/h29-39H,19-20,24,28H2,1-18H3 |
| InChIKey | LBJKRTFBXPGUCY-UHFFFAOYSA-N |
| XLogP | 16.06 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 900.13 |
| LogP ≤ 5 | 16.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|