C18H32O7 — CID 46850185
methyl 2-[(3S,4S,6R)-6-[(E,4S,7S)-4,7-dihydroxy-6-methyloct-5-enyl]-6-methoxy-4-methyldioxan-3-yl]acetate (PubChem CID 46850185) has the molecular formula C18H32O7 and a molecular weight of 360.45 g/mol. Its IUPAC name is methyl 2-[(3S,4S,6R)-6-[(E,4S,7S)-4,7-dihydroxy-6-methyloct-5-enyl]-6-methoxy-4-methyldioxan-3-yl]acetate.
| Compound Name | methyl 2-[(3S,4S,6R)-6-[(E,4S,7S)-4,7-dihydroxy-6-methyloct-5-enyl]-6-methoxy-4-methyldioxan-3-yl]acetate |
|---|---|
| PubChem CID | 46850185 |
| Molecular Formula | C18H32O7 |
| Molecular Weight | 360.45 g/mol |
| Exact Mass | 360.21 |
| IUPAC Name | methyl 2-[(3S,4S,6R)-6-[(E,4S,7S)-4,7-dihydroxy-6-methyloct-5-enyl]-6-methoxy-4-methyldioxan-3-yl]acetate |
| SMILES | COC(=O)C[C@@H]1OO[C@@](CCC[C@H](O)/C=C(\C)[C@H](C)O)(OC)C[C@@H]1C |
| InChI | InChI=1S/C18H32O7/c1-12(14(3)19)9-15(20)7-6-8-18(23-5)11-13(2)16(24-25-18)10-17(21)22-4/h9,13-16,19-20H,6-8,10-11H2,1-5H3/b12-9+/t13-,14-,15-,16-,18+/m0/s1 |
| InChIKey | RYTLTFXUUGNKPI-QPRNDSPNSA-N |
| XLogP | 2.11 |
| TPSA | 94.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.45 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|